C18H19N3O5 — CID 170631414
4-(2,6-dioxopiperidin-3-yl)-5-piperidin-4-yloxyisoindole-1,3-dione (PubChem CID 170631414) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 4-(2,6-dioxopiperidin-3-yl)-5-piperidin-4-yloxyisoindole-1,3-dione.
| Compound Name | 4-(2,6-dioxopiperidin-3-yl)-5-piperidin-4-yloxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 170631414 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 4-(2,6-dioxopiperidin-3-yl)-5-piperidin-4-yloxyisoindole-1,3-dione |
| SMILES | O=C1CCC(c2c(OC3CCNCC3)ccc3c2C(=O)NC3=O)C(=O)N1 |
| InChI | InChI=1S/C18H19N3O5/c22-13-4-2-10(16(23)20-13)14-12(26-9-5-7-19-8-6-9)3-1-11-15(14)18(25)21-17(11)24/h1,3,9-10,19H,2,4-8H2,(H,20,22,23)(H,21,24,25) |
| InChIKey | VBSHLAVNTZZXGA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|