C19H23NO5 — CID 175902612
4-[4-[(3R)-2,6-dioxopiperidin-3-yl]-2-methylphenoxy]cyclohexane-1-carboxylic acid (PubChem CID 175902612) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-[4-[(3R)-2,6-dioxopiperidin-3-yl]-2-methylphenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[(3R)-2,6-dioxopiperidin-3-yl]-2-methylphenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 175902612 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 4-[4-[(3R)-2,6-dioxopiperidin-3-yl]-2-methylphenoxy]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc([C@H]2CCC(=O)NC2=O)ccc1OC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C19H23NO5/c1-11-10-13(15-7-9-17(21)20-18(15)22)4-8-16(11)25-14-5-2-12(3-6-14)19(23)24/h4,8,10,12,14-15H,2-3,5-7,9H2,1H3,(H,23,24)(H,20,21,22)/t12?,14?,15-/m1/s1 |
| InChIKey | KOSFDMYBMKYKRO-PESDSKBTSA-N |
| XLogP | 2.54 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|