C19H19NO5 — CID 171853489
3-[3-[4-(2,6-dioxopiperidin-3-yl)phenyl]prop-2-ynoxy]cyclobutane-1-carboxylic acid (PubChem CID 171853489) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-[3-[4-(2,6-dioxopiperidin-3-yl)phenyl]prop-2-ynoxy]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[3-[4-(2,6-dioxopiperidin-3-yl)phenyl]prop-2-ynoxy]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 171853489 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-[3-[4-(2,6-dioxopiperidin-3-yl)phenyl]prop-2-ynoxy]cyclobutane-1-carboxylic acid |
| SMILES | O=C1CCC(c2ccc(C#CCOC3CC(C(=O)O)C3)cc2)C(=O)N1 |
| InChI | InChI=1S/C19H19NO5/c21-17-8-7-16(18(22)20-17)13-5-3-12(4-6-13)2-1-9-25-15-10-14(11-15)19(23)24/h3-6,14-16H,7-11H2,(H,23,24)(H,20,21,22) |
| InChIKey | CIBBWERLRKWAKU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|