C30H44N5O4S+ — CID 177052442
(4-aminopiperidin-1-yl)-[4-[[4-[3-[4-(2,6-dioxopiperidin-3-yl)phenyl]prop-2-ynoxy]piperidin-1-yl]methyl]piperidin-1-yl]-hydroxysulfanium (PubChem CID 177052442) has the molecular formula C30H44N5O4S+ and a molecular weight of 570.78 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[4-[[4-[3-[4-(2,6-dioxopiperidin-3-yl)phenyl]prop-2-ynoxy]piperidin-1-yl]methyl]piperidin-1-yl]-hydroxysulfanium.
| Compound Name | (4-aminopiperidin-1-yl)-[4-[[4-[3-[4-(2,6-dioxopiperidin-3-yl)phenyl]prop-2-ynoxy]piperidin-1-yl]methyl]piperidin-1-yl]-hydroxysulfanium |
|---|---|
| PubChem CID | 177052442 |
| Molecular Formula | C30H44N5O4S+ |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[4-[[4-[3-[4-(2,6-dioxopiperidin-3-yl)phenyl]prop-2-ynoxy]piperidin-1-yl]methyl]piperidin-1-yl]-hydroxysulfanium |
| SMILES | NC1CCN([S+](O)N2CCC(CN3CCC(OCC#Cc4ccc(C5CCC(=O)NC5=O)cc4)CC3)CC2)CC1 |
| InChI | InChI=1S/C30H43N5O4S/c31-26-11-19-35(20-12-26)40(38)34-17-9-24(10-18-34)22-33-15-13-27(14-16-33)39-21-1-2-23-3-5-25(6-4-23)28-7-8-29(36)32-30(28)37/h3-6,24,26-28,38H,7-22,31H2/p+1 |
| InChIKey | ABHDOZIYCTXMNN-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|