C24H30N2O3 — CID 177052290
3-[3-[3-(3-azaspiro[5.5]undecan-9-yloxy)prop-1-ynyl]phenyl]piperidine-2,6-dione (PubChem CID 177052290) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-[3-[3-(3-azaspiro[5.5]undecan-9-yloxy)prop-1-ynyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[3-[3-(3-azaspiro[5.5]undecan-9-yloxy)prop-1-ynyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177052290 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 3-[3-[3-(3-azaspiro[5.5]undecan-9-yloxy)prop-1-ynyl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(C#CCOC3CCC4(CCNCC4)CC3)c2)C(=O)N1 |
| InChI | InChI=1S/C24H30N2O3/c27-22-7-6-21(23(28)26-22)19-5-1-3-18(17-19)4-2-16-29-20-8-10-24(11-9-20)12-14-25-15-13-24/h1,3,5,17,20-21,25H,6-16H2,(H,26,27,28) |
| InChIKey | BKCMYNLSXGSAPL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|