C38H49FN5O6S+ — CID 177052632
CID 177052632 (PubChem CID 177052632) has the molecular formula C38H49FN5O6S+ and a molecular weight of 722.90 g/mol.
| Compound Name | CID 177052632 |
|---|---|
| PubChem CID | 177052632 |
| Molecular Formula | C38H49FN5O6S+ |
| Molecular Weight | 722.90 g/mol |
| Exact Mass | 722.34 |
| IUPAC Name | — |
| SMILES | Nc1ccc([S+](=O)(O)NC2CCC(C(=O)N3CCC(CN4CCC(OCC#Cc5cccc(C6CCC(=O)NC6=O)c5)CC4)CC3)CC2)cc1F |
| InChI | InChI=1S/C38H48FN5O6S/c39-34-24-32(10-12-35(34)40)51(48,49)42-30-8-6-28(7-9-30)38(47)44-20-14-27(15-21-44)25-43-18-16-31(17-19-43)50-22-2-4-26-3-1-5-29(23-26)33-11-13-36(45)41-37(33)46/h1,3,5,10,12,23-24,27-28,30-31,33H,6-9,11,13-22,25H2,(H4-,40,41,42,45,46,48,49)/p+1 |
| InChIKey | JIVIGMKYTQNTNK-UHFFFAOYSA-O |
| XLogP | 4.09 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.90 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|