C18H15F3N2O5 — CID 138466808
4-cyclobutyloxy-2-(2,6-dioxopiperidin-3-yl)-7-(trifluoromethyl)isoindole-1,3-dione (PubChem CID 138466808) has the molecular formula C18H15F3N2O5 and a molecular weight of 396.32 g/mol. Its IUPAC name is 4-cyclobutyloxy-2-(2,6-dioxopiperidin-3-yl)-7-(trifluoromethyl)isoindole-1,3-dione.
| Compound Name | 4-cyclobutyloxy-2-(2,6-dioxopiperidin-3-yl)-7-(trifluoromethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 138466808 |
| Molecular Formula | C18H15F3N2O5 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 4-cyclobutyloxy-2-(2,6-dioxopiperidin-3-yl)-7-(trifluoromethyl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3c(OC4CCC4)ccc(C(F)(F)F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H15F3N2O5/c19-18(20,21)9-4-6-11(28-8-2-1-3-8)14-13(9)16(26)23(17(14)27)10-5-7-12(24)22-15(10)25/h4,6,8,10H,1-3,5,7H2,(H,22,24,25) |
| InChIKey | HLWWTMLSWDZTLX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|