C18H20N2O4 — CID 138628553
4-tert-butyl-2-(2,7-dioxoazepan-3-yl)isoindole-1,3-dione (PubChem CID 138628553) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-tert-butyl-2-(2,7-dioxoazepan-3-yl)isoindole-1,3-dione.
| Compound Name | 4-tert-butyl-2-(2,7-dioxoazepan-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 138628553 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 4-tert-butyl-2-(2,7-dioxoazepan-3-yl)isoindole-1,3-dione |
| SMILES | CC(C)(C)c1cccc2c1C(=O)N(C1CCCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C18H20N2O4/c1-18(2,3)11-7-4-6-10-14(11)17(24)20(16(10)23)12-8-5-9-13(21)19-15(12)22/h4,6-7,12H,5,8-9H2,1-3H3,(H,19,21,22) |
| InChIKey | AVEZOSIHLOZEPW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|