C12H9BrF3NO2 — CID 171846052
3-[3-bromo-2-(trifluoromethyl)phenyl]piperidine-2,6-dione (PubChem CID 171846052) has the molecular formula C12H9BrF3NO2 and a molecular weight of 336.11 g/mol. Its IUPAC name is 3-[3-bromo-2-(trifluoromethyl)phenyl]piperidine-2,6-dione.
| Compound Name | 3-[3-bromo-2-(trifluoromethyl)phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171846052 |
| Molecular Formula | C12H9BrF3NO2 |
| Molecular Weight | 336.11 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 3-[3-bromo-2-(trifluoromethyl)phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cccc(Br)c2C(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C12H9BrF3NO2/c13-8-3-1-2-6(10(8)12(14,15)16)7-4-5-9(18)17-11(7)19/h1-3,7H,4-5H2,(H,17,18,19) |
| InChIKey | JTMNRSDNRYHJEU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.11 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|