C15H16F3NO2 — CID 170052287
3-[5-propan-2-yl-2-(trifluoromethyl)phenyl]piperidine-2,6-dione (PubChem CID 170052287) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 3-[5-propan-2-yl-2-(trifluoromethyl)phenyl]piperidine-2,6-dione.
| Compound Name | 3-[5-propan-2-yl-2-(trifluoromethyl)phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170052287 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-[5-propan-2-yl-2-(trifluoromethyl)phenyl]piperidine-2,6-dione |
| SMILES | CC(C)c1ccc(C(F)(F)F)c(C2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C15H16F3NO2/c1-8(2)9-3-5-12(15(16,17)18)11(7-9)10-4-6-13(20)19-14(10)21/h3,5,7-8,10H,4,6H2,1-2H3,(H,19,20,21) |
| InChIKey | MOROQWVCBRNAHR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|