C14H18FNO2 — CID 176684006
ethane;3-(2-fluoro-4-methylphenyl)piperidine-2,6-dione (PubChem CID 176684006) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is ethane;3-(2-fluoro-4-methylphenyl)piperidine-2,6-dione.
| Compound Name | ethane;3-(2-fluoro-4-methylphenyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 176684006 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | ethane;3-(2-fluoro-4-methylphenyl)piperidine-2,6-dione |
| SMILES | CC.Cc1ccc(C2CCC(=O)NC2=O)c(F)c1 |
| InChI | InChI=1S/C12H12FNO2.C2H6/c1-7-2-3-8(10(13)6-7)9-4-5-11(15)14-12(9)16;1-2/h2-3,6,9H,4-5H2,1H3,(H,14,15,16);1-2H3 |
| InChIKey | MOPCDWRCYNAFPM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|