C18H21FN2O3 — CID 168874545
2-[1-[4-(2,6-dioxopiperidin-3-yl)-3-fluorophenyl]piperidin-4-yl]acetaldehyde (PubChem CID 168874545) has the molecular formula C18H21FN2O3 and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-[1-[4-(2,6-dioxopiperidin-3-yl)-3-fluorophenyl]piperidin-4-yl]acetaldehyde.
| Compound Name | 2-[1-[4-(2,6-dioxopiperidin-3-yl)-3-fluorophenyl]piperidin-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 168874545 |
| Molecular Formula | C18H21FN2O3 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-[1-[4-(2,6-dioxopiperidin-3-yl)-3-fluorophenyl]piperidin-4-yl]acetaldehyde |
| SMILES | O=CCC1CCN(c2ccc(C3CCC(=O)NC3=O)c(F)c2)CC1 |
| InChI | InChI=1S/C18H21FN2O3/c19-16-11-13(21-8-5-12(6-9-21)7-10-22)1-2-14(16)15-3-4-17(23)20-18(15)24/h1-2,10-12,15H,3-9H2,(H,20,23,24) |
| InChIKey | HMTSRXNBPKDGHI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|