C18H22FN3O4 — CID 171626777
N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-[4-(hydroxymethyl)piperidin-1-yl]benzamide (PubChem CID 171626777) has the molecular formula C18H22FN3O4 and a molecular weight of 363.39 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-[4-(hydroxymethyl)piperidin-1-yl]benzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-[4-(hydroxymethyl)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 171626777 |
| Molecular Formula | C18H22FN3O4 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-[4-(hydroxymethyl)piperidin-1-yl]benzamide |
| SMILES | O=C1CCC(NC(=O)c2ccc(N3CCC(CO)CC3)cc2F)C(=O)N1 |
| InChI | InChI=1S/C18H22FN3O4/c19-14-9-12(22-7-5-11(10-23)6-8-22)1-2-13(14)17(25)20-15-3-4-16(24)21-18(15)26/h1-2,9,11,15,23H,3-8,10H2,(H,20,25)(H,21,24,26) |
| InChIKey | MDOUPFRLCWEQRG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|