C18H18FN3O4 — CID 176914974
N-[(3S)-2,6-bis(oxomethylidene)piperidin-3-yl]-2-fluoro-4-[3-(hydroxymethyl)azetidin-1-yl]benzamide (PubChem CID 176914974) has the molecular formula C18H18FN3O4 and a molecular weight of 359.36 g/mol. Its IUPAC name is N-[(3S)-2,6-bis(oxomethylidene)piperidin-3-yl]-2-fluoro-4-[3-(hydroxymethyl)azetidin-1-yl]benzamide.
| Compound Name | N-[(3S)-2,6-bis(oxomethylidene)piperidin-3-yl]-2-fluoro-4-[3-(hydroxymethyl)azetidin-1-yl]benzamide |
|---|---|
| PubChem CID | 176914974 |
| Molecular Formula | C18H18FN3O4 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[(3S)-2,6-bis(oxomethylidene)piperidin-3-yl]-2-fluoro-4-[3-(hydroxymethyl)azetidin-1-yl]benzamide |
| SMILES | O=C=C1CC[C@H](NC(=O)c2ccc(N3CC(CO)C3)cc2F)C(=C=O)N1 |
| InChI | InChI=1S/C18H18FN3O4/c19-15-5-13(22-6-11(7-22)8-23)2-3-14(15)18(26)21-16-4-1-12(9-24)20-17(16)10-25/h2-3,5,11,16,20,23H,1,4,6-8H2,(H,21,26)/t16-/m0/s1 |
| InChIKey | MKDHLXAPTSNFPG-INIZCTEOSA-N |
| XLogP | 0.17 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|