C21H24F4N4O5 — CID 175975873
4-(2,7-diazaspiro[3.5]nonan-2-yl)-N-(2,6-dioxopiperidin-3-yl)-2-fluorobenzamide;2,2,2-trifluoroacetic acid (PubChem CID 175975873) has the molecular formula C21H24F4N4O5 and a molecular weight of 488.44 g/mol. Its IUPAC name is 4-(2,7-diazaspiro[3.5]nonan-2-yl)-N-(2,6-dioxopiperidin-3-yl)-2-fluorobenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(2,7-diazaspiro[3.5]nonan-2-yl)-N-(2,6-dioxopiperidin-3-yl)-2-fluorobenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175975873 |
| Molecular Formula | C21H24F4N4O5 |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 4-(2,7-diazaspiro[3.5]nonan-2-yl)-N-(2,6-dioxopiperidin-3-yl)-2-fluorobenzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CCC(NC(=O)c2ccc(N3CC4(CCNCC4)C3)cc2F)C(=O)N1 |
| InChI | InChI=1S/C19H23FN4O3.C2HF3O2/c20-14-9-12(24-10-19(11-24)5-7-21-8-6-19)1-2-13(14)17(26)22-15-3-4-16(25)23-18(15)27;3-2(4,5)1(6)7/h1-2,9,15,21H,3-8,10-11H2,(H,22,26)(H,23,25,27);(H,6,7) |
| InChIKey | GDPJLKFDPVTUEE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|