C15H19N5O3 — CID 172609767
N-(2,6-dioxopiperidin-3-yl)-4-piperazin-1-ylpyridine-2-carboxamide (PubChem CID 172609767) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-4-piperazin-1-ylpyridine-2-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-4-piperazin-1-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 172609767 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-4-piperazin-1-ylpyridine-2-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2cc(N3CCNCC3)ccn2)C(=O)N1 |
| InChI | InChI=1S/C15H19N5O3/c21-13-2-1-11(14(22)19-13)18-15(23)12-9-10(3-4-17-12)20-7-5-16-6-8-20/h3-4,9,11,16H,1-2,5-8H2,(H,18,23)(H,19,21,22) |
| InChIKey | GLQINEGLALNIBZ-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|