C23H26N4O5 — CID 153384923
N-(2,6-dioxopiperidin-3-yl)-4-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]pyridine-2-carboxamide (PubChem CID 153384923) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-4-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]pyridine-2-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-4-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 153384923 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-4-[[4-(morpholin-4-ylmethyl)phenyl]methoxy]pyridine-2-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2cc(OCc3ccc(CN4CCOCC4)cc3)ccn2)C(=O)N1 |
| InChI | InChI=1S/C23H26N4O5/c28-21-6-5-19(22(29)26-21)25-23(30)20-13-18(7-8-24-20)32-15-17-3-1-16(2-4-17)14-27-9-11-31-12-10-27/h1-4,7-8,13,19H,5-6,9-12,14-15H2,(H,25,30)(H,26,28,29) |
| InChIKey | IHJJEUMUUMRZKN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|