C21H18N4O4 — CID 175423540
N-(2,8-dioxo-5,6,7,9-tetrahydro-1H-pyrido[2,3-b]azepin-7-yl)-4-phenoxypyridine-2-carboxamide (PubChem CID 175423540) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is N-(2,8-dioxo-5,6,7,9-tetrahydro-1H-pyrido[2,3-b]azepin-7-yl)-4-phenoxypyridine-2-carboxamide.
| Compound Name | N-(2,8-dioxo-5,6,7,9-tetrahydro-1H-pyrido[2,3-b]azepin-7-yl)-4-phenoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 175423540 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-(2,8-dioxo-5,6,7,9-tetrahydro-1H-pyrido[2,3-b]azepin-7-yl)-4-phenoxypyridine-2-carboxamide |
| SMILES | O=C(NC1CCc2ccc(=O)[nH]c2NC1=O)c1cc(Oc2ccccc2)ccn1 |
| InChI | InChI=1S/C21H18N4O4/c26-18-9-7-13-6-8-16(20(27)25-19(13)24-18)23-21(28)17-12-15(10-11-22-17)29-14-4-2-1-3-5-14/h1-5,7,9-12,16H,6,8H2,(H,23,28)(H2,24,25,26,27) |
| InChIKey | OERXCGBPPRFRHR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |