C11H11N3O3 — CID 175992021
N-[(3R)-2,6-dioxopiperidin-3-yl]pyridine-2-carboxamide (PubChem CID 175992021) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is N-[(3R)-2,6-dioxopiperidin-3-yl]pyridine-2-carboxamide.
| Compound Name | N-[(3R)-2,6-dioxopiperidin-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175992021 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N-[(3R)-2,6-dioxopiperidin-3-yl]pyridine-2-carboxamide |
| SMILES | O=C1CC[C@@H](NC(=O)c2ccccn2)C(=O)N1 |
| InChI | InChI=1S/C11H11N3O3/c15-9-5-4-8(11(17)14-9)13-10(16)7-3-1-2-6-12-7/h1-3,6,8H,4-5H2,(H,13,16)(H,14,15,17)/t8-/m1/s1 |
| InChIKey | MMPCNYVDMALQGW-MRVPVSSYSA-N |
| XLogP | -0.38 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|