C15H15N5O3 — CID 146129208
N-(2,6-dioxopiperidin-3-yl)-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide (PubChem CID 146129208) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 146129208 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC2CCC(=O)NC2=O)cnn1-c1ccccn1 |
| InChI | InChI=1S/C15H15N5O3/c1-9-10(8-17-20(9)12-4-2-3-7-16-12)14(22)18-11-5-6-13(21)19-15(11)23/h2-4,7-8,11H,5-6H2,1H3,(H,18,22)(H,19,21,23) |
| InChIKey | QMPNAXYDYWPQGJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|