C16H20N2O4 — CID 144714237
2-acetyl-N-(2,6-dioxopiperidin-3-yl)benzamide;ethane (PubChem CID 144714237) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-acetyl-N-(2,6-dioxopiperidin-3-yl)benzamide;ethane.
| Compound Name | 2-acetyl-N-(2,6-dioxopiperidin-3-yl)benzamide;ethane |
|---|---|
| PubChem CID | 144714237 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-acetyl-N-(2,6-dioxopiperidin-3-yl)benzamide;ethane |
| SMILES | CC.CC(=O)c1ccccc1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H14N2O4.C2H6/c1-8(17)9-4-2-3-5-10(9)13(19)15-11-6-7-12(18)16-14(11)20;1-2/h2-5,11H,6-7H2,1H3,(H,15,19)(H,16,18,20);1-2H3 |
| InChIKey | HCCHAGOGTBAOPN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|