C18H16N2O3 — CID 138467355
N-(2,6-dioxopiperidin-3-yl)-3-phenylbenzamide (PubChem CID 138467355) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-3-phenylbenzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-3-phenylbenzamide |
|---|---|
| PubChem CID | 138467355 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-3-phenylbenzamide |
| SMILES | O=C1CCC(NC(=O)c2cccc(-c3ccccc3)c2)C(=O)N1 |
| InChI | InChI=1S/C18H16N2O3/c21-16-10-9-15(18(23)20-16)19-17(22)14-8-4-7-13(11-14)12-5-2-1-3-6-12/h1-8,11,15H,9-10H2,(H,19,22)(H,20,21,23) |
| InChIKey | FTEVRSUYJVBYDE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|