C12H11ClN2O3 — CID 2363882
4-chloro-N-[(3R)-2,6-dioxopiperidin-3-yl]benzamide (PubChem CID 2363882) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is 4-chloro-N-[(3R)-2,6-dioxopiperidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(3R)-2,6-dioxopiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 2363882 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 4-chloro-N-[(3R)-2,6-dioxopiperidin-3-yl]benzamide |
| SMILES | O=C1CC[C@@H](NC(=O)c2ccc(Cl)cc2)C(=O)N1 |
| InChI | InChI=1S/C12H11ClN2O3/c13-8-3-1-7(2-4-8)11(17)14-9-5-6-10(16)15-12(9)18/h1-4,9H,5-6H2,(H,14,17)(H,15,16,18)/t9-/m1/s1 |
| InChIKey | WZJABSNOIBPFBM-SECBINFHSA-N |
| XLogP | 0.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|