C13H11N3O4 — CID 154810751
N-(2,6-dioxopiperidin-3-yl)-1,3-benzoxazole-5-carboxamide (PubChem CID 154810751) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 154810751 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-1,3-benzoxazole-5-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2ccc3ocnc3c2)C(=O)N1 |
| InChI | InChI=1S/C13H11N3O4/c17-11-4-2-8(13(19)16-11)15-12(18)7-1-3-10-9(5-7)14-6-20-10/h1,3,5-6,8H,2,4H2,(H,15,18)(H,16,17,19) |
| InChIKey | XFOPCIRQHUHRPJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|