C18H14N4O4 — CID 154810892
N-(2,6-dioxopiperidin-3-yl)-2-pyridin-2-yl-1,3-benzoxazole-5-carboxamide (PubChem CID 154810892) has the molecular formula C18H14N4O4 and a molecular weight of 350.33 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-pyridin-2-yl-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-pyridin-2-yl-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 154810892 |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-pyridin-2-yl-1,3-benzoxazole-5-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2ccc3oc(-c4ccccn4)nc3c2)C(=O)N1 |
| InChI | InChI=1S/C18H14N4O4/c23-15-7-5-11(17(25)22-15)20-16(24)10-4-6-14-13(9-10)21-18(26-14)12-3-1-2-8-19-12/h1-4,6,8-9,11H,5,7H2,(H,20,24)(H,22,23,25) |
| InChIKey | ANYBXODTJOQRAV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|