C19H14N2O5 — CID 154810863
N-(2,6-dioxopiperidin-3-yl)-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 154810863) has the molecular formula C19H14N2O5 and a molecular weight of 350.33 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 154810863 |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2cc3c(ccc4ccccc43)oc2=O)C(=O)N1 |
| InChI | InChI=1S/C19H14N2O5/c22-16-8-6-14(18(24)21-16)20-17(23)13-9-12-11-4-2-1-3-10(11)5-7-15(12)26-19(13)25/h1-5,7,9,14H,6,8H2,(H,20,23)(H,21,22,24) |
| InChIKey | AFEZZXHOTHCTAN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|