C16H14N2O6 — CID 146129250
N-(2,6-dioxopiperidin-3-yl)-8-methoxy-2-oxochromene-3-carboxamide (PubChem CID 146129250) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-8-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-8-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 146129250 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-8-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NC3CCC(=O)NC3=O)c(=O)oc12 |
| InChI | InChI=1S/C16H14N2O6/c1-23-11-4-2-3-8-7-9(16(22)24-13(8)11)14(20)17-10-5-6-12(19)18-15(10)21/h2-4,7,10H,5-6H2,1H3,(H,17,20)(H,18,19,21) |
| InChIKey | QEHOTCSZQHZIIC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|