C22H26N2O6 — CID 75280116
8-methoxy-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]-2-oxochromene-3-carboxamide (PubChem CID 75280116) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 8-methoxy-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]-2-oxochromene-3-carboxamide.
| Compound Name | 8-methoxy-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 75280116 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 8-methoxy-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]-2-oxochromene-3-carboxamide |
| SMILES | COCC1CC(=O)NC2CC(NC(=O)c3cc4cccc(OC)c4oc3=O)CCC12 |
| InChI | InChI=1S/C22H26N2O6/c1-28-11-13-9-19(25)24-17-10-14(6-7-15(13)17)23-21(26)16-8-12-4-3-5-18(29-2)20(12)30-22(16)27/h3-5,8,13-15,17H,6-7,9-11H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | LNGDMYUCEOIFQX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|