C18H22ClFN2O3 — CID 75279999
2-chloro-6-fluoro-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]benzamide (PubChem CID 75279999) has the molecular formula C18H22ClFN2O3 and a molecular weight of 368.84 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]benzamide |
|---|---|
| PubChem CID | 75279999 |
| Molecular Formula | C18H22ClFN2O3 |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-chloro-6-fluoro-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]benzamide |
| SMILES | COCC1CC(=O)NC2CC(NC(=O)c3c(F)cccc3Cl)CCC12 |
| InChI | InChI=1S/C18H22ClFN2O3/c1-25-9-10-7-16(23)22-15-8-11(5-6-12(10)15)21-18(24)17-13(19)3-2-4-14(17)20/h2-4,10-12,15H,5-9H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | OFJHNYGHSNUDDT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |