C22H33N3O5S — CID 75280052
4-(diethylsulfamoyl)-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]benzamide (PubChem CID 75280052) has the molecular formula C22H33N3O5S and a molecular weight of 451.59 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]benzamide |
|---|---|
| PubChem CID | 75280052 |
| Molecular Formula | C22H33N3O5S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NC2CCC3C(COC)CC(=O)NC3C2)cc1 |
| InChI | InChI=1S/C22H33N3O5S/c1-4-25(5-2)31(28,29)18-9-6-15(7-10-18)22(27)23-17-8-11-19-16(14-30-3)12-21(26)24-20(19)13-17/h6-7,9-10,16-17,19-20H,4-5,8,11-14H2,1-3H3,(H,23,27)(H,24,26) |
| InChIKey | IWZGBDCLJGCDBC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |