C16H23N3O3S — CID 167846590
N-[(1S,4S,5R)-2-azabicyclo[2.1.1]hexan-5-yl]-4-(diethylsulfamoyl)benzamide (PubChem CID 167846590) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is N-[(1S,4S,5R)-2-azabicyclo[2.1.1]hexan-5-yl]-4-(diethylsulfamoyl)benzamide.
| Compound Name | N-[(1S,4S,5R)-2-azabicyclo[2.1.1]hexan-5-yl]-4-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 167846590 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[(1S,4S,5R)-2-azabicyclo[2.1.1]hexan-5-yl]-4-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)N[C@@H]2[C@@H]3CN[C@H]2C3)cc1 |
| InChI | InChI=1S/C16H23N3O3S/c1-3-19(4-2)23(21,22)13-7-5-11(6-8-13)16(20)18-15-12-9-14(15)17-10-12/h5-8,12,14-15,17H,3-4,9-10H2,1-2H3,(H,18,20)/t12-,14-,15+/m0/s1 |
| InChIKey | ABYLZDSJWAHIAU-AEGPPILISA-N |
| XLogP | 0.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |