C22H32N2O2 — CID 75280461
4-tert-butyl-N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)benzamide (PubChem CID 75280461) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 4-tert-butyl-N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)benzamide.
| Compound Name | 4-tert-butyl-N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 75280461 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 4-tert-butyl-N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)benzamide |
| SMILES | CCC1CC(=O)NC2CC(NC(=O)c3ccc(C(C)(C)C)cc3)CCC12 |
| InChI | InChI=1S/C22H32N2O2/c1-5-14-12-20(25)24-19-13-17(10-11-18(14)19)23-21(26)15-6-8-16(9-7-15)22(2,3)4/h6-9,14,17-19H,5,10-13H2,1-4H3,(H,23,26)(H,24,25) |
| InChIKey | PCUGHQGOLYLPBL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |