C19H25FN2O3 — CID 75280528
N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-2-(2-fluorophenoxy)acetamide (PubChem CID 75280528) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-2-(2-fluorophenoxy)acetamide.
| Compound Name | N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-2-(2-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 75280528 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-2-(2-fluorophenoxy)acetamide |
| SMILES | CCC1CC(=O)NC2CC(NC(=O)COc3ccccc3F)CCC12 |
| InChI | InChI=1S/C19H25FN2O3/c1-2-12-9-18(23)22-16-10-13(7-8-14(12)16)21-19(24)11-25-17-6-4-3-5-15(17)20/h3-6,12-14,16H,2,7-11H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | OCAUWZDDEHANGO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |