C21H26N2O4 — CID 75280400
N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-7-methoxy-1-benzofuran-2-carboxamide (PubChem CID 75280400) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-7-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-7-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 75280400 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-7-methoxy-1-benzofuran-2-carboxamide |
| SMILES | CCC1CC(=O)NC2CC(NC(=O)c3cc4cccc(OC)c4o3)CCC12 |
| InChI | InChI=1S/C21H26N2O4/c1-3-12-10-19(24)23-16-11-14(7-8-15(12)16)22-21(25)18-9-13-5-4-6-17(26-2)20(13)27-18/h4-6,9,12,14-16H,3,7-8,10-11H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | SELGQNKTRMDIKM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |