C22H26N2O5 — CID 75280616
N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-8-methoxy-2-oxochromene-3-carboxamide (PubChem CID 75280616) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-8-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-8-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 75280616 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-8-methoxy-2-oxochromene-3-carboxamide |
| SMILES | CCC1CC(=O)NC2CC(NC(=O)c3cc4cccc(OC)c4oc3=O)CCC12 |
| InChI | InChI=1S/C22H26N2O5/c1-3-12-10-19(25)24-17-11-14(7-8-15(12)17)23-21(26)16-9-13-5-4-6-18(28-2)20(13)29-22(16)27/h4-6,9,12,14-15,17H,3,7-8,10-11H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | SAVYGVRQSCICSY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|