C18H23FN2O2 — CID 75280478
N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-3-fluorobenzamide (PubChem CID 75280478) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-3-fluorobenzamide.
| Compound Name | N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 75280478 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-3-fluorobenzamide |
| SMILES | CCC1CC(=O)NC2CC(NC(=O)c3cccc(F)c3)CCC12 |
| InChI | InChI=1S/C18H23FN2O2/c1-2-11-9-17(22)21-16-10-14(6-7-15(11)16)20-18(23)12-4-3-5-13(19)8-12/h3-5,8,11,14-16H,2,6-7,9-10H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | RBYSUTGHDVHNRF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |