C20H28N2O2 — CID 75278967
2-methyl-N-(2-oxo-4-propyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)benzamide (PubChem CID 75278967) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-methyl-N-(2-oxo-4-propyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)benzamide.
| Compound Name | 2-methyl-N-(2-oxo-4-propyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 75278967 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 2-methyl-N-(2-oxo-4-propyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)benzamide |
| SMILES | CCCC1CC(=O)NC2CC(NC(=O)c3ccccc3C)CCC12 |
| InChI | InChI=1S/C20H28N2O2/c1-3-6-14-11-19(23)22-18-12-15(9-10-17(14)18)21-20(24)16-8-5-4-7-13(16)2/h4-5,7-8,14-15,17-18H,3,6,9-12H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | QHCZARHJJOJGCI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |