C18H25N3O2 — CID 78387009
4-tert-butyl-N-(2-oxo-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-5-yl)benzamide (PubChem CID 78387009) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-oxo-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-5-yl)benzamide.
| Compound Name | 4-tert-butyl-N-(2-oxo-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-5-yl)benzamide |
|---|---|
| PubChem CID | 78387009 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 4-tert-butyl-N-(2-oxo-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-5-yl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC2CCC3NC(=O)NC3C2)cc1 |
| InChI | InChI=1S/C18H25N3O2/c1-18(2,3)12-6-4-11(5-7-12)16(22)19-13-8-9-14-15(10-13)21-17(23)20-14/h4-7,13-15H,8-10H2,1-3H3,(H,19,22)(H2,20,21,23) |
| InChIKey | DJSYNKUKXRLASZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |