C12H14N2O4S — CID 156745010
N-(2,6-dioxopiperidin-3-yl)-4-methoxy-2-methylthiophene-3-carboxamide (PubChem CID 156745010) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-4-methoxy-2-methylthiophene-3-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-4-methoxy-2-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 156745010 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-4-methoxy-2-methylthiophene-3-carboxamide |
| SMILES | COc1csc(C)c1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C12H14N2O4S/c1-6-10(8(18-2)5-19-6)12(17)13-7-3-4-9(15)14-11(7)16/h5,7H,3-4H2,1-2H3,(H,13,17)(H,14,15,16) |
| InChIKey | LDFYMACTUHKJRK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|