C16H17N3O4 — CID 174330620
N-(2,6-dioxopiperidin-3-yl)-4-methoxy-2-methyl-3H-indole-7-carboxamide (PubChem CID 174330620) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-4-methoxy-2-methyl-3H-indole-7-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-4-methoxy-2-methyl-3H-indole-7-carboxamide |
|---|---|
| PubChem CID | 174330620 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-4-methoxy-2-methyl-3H-indole-7-carboxamide |
| SMILES | COc1ccc(C(=O)NC2CCC(=O)NC2=O)c2c1CC(C)=N2 |
| InChI | InChI=1S/C16H17N3O4/c1-8-7-10-12(23-2)5-3-9(14(10)17-8)15(21)18-11-4-6-13(20)19-16(11)22/h3,5,11H,4,6-7H2,1-2H3,(H,18,21)(H,19,20,22) |
| InChIKey | ROFUFRDSPUMVNH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|