C15H21N2O4W- — CID 165136668
N-(2,6-dioxopiperidin-3-yl)-5-methoxycyclohexa-1,5-diene-1-carboxamide;ethane;tungsten (PubChem CID 165136668) has the molecular formula C15H21N2O4W- and a molecular weight of 477.18 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-5-methoxycyclohexa-1,5-diene-1-carboxamide;ethane;tungsten.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-5-methoxycyclohexa-1,5-diene-1-carboxamide;ethane;tungsten |
|---|---|
| PubChem CID | 165136668 |
| Molecular Formula | C15H21N2O4W- |
| Molecular Weight | 477.18 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-5-methoxycyclohexa-1,5-diene-1-carboxamide;ethane;tungsten |
| SMILES | CC.COC1=[C-]C(C(=O)NC2CCC(=O)NC2=O)=CCC1.[W] |
| InChI | InChI=1S/C13H15N2O4.C2H6.W/c1-19-9-4-2-3-8(7-9)12(17)14-10-5-6-11(16)15-13(10)18;1-2;/h3,10H,2,4-6H2,1H3,(H,14,17)(H,15,16,18);1-2H3;/q-1;; |
| InChIKey | AGVJWTDABKIEPH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|