C16H19FN3O4W- — CID 166077741
4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-methoxycyclohepta-1,3,6-triene-1-carboxamide;tungsten (PubChem CID 166077741) has the molecular formula C16H19FN3O4W- and a molecular weight of 520.18 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-methoxycyclohepta-1,3,6-triene-1-carboxamide;tungsten.
| Compound Name | 4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-methoxycyclohepta-1,3,6-triene-1-carboxamide;tungsten |
|---|---|
| PubChem CID | 166077741 |
| Molecular Formula | C16H19FN3O4W- |
| Molecular Weight | 520.18 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-methoxycyclohepta-1,3,6-triene-1-carboxamide;tungsten |
| SMILES | COC1=[C-]C(C(=O)NC2CCC(=O)NC2=O)=CC=C(N(C)C)C1F.[W] |
| InChI | InChI=1S/C16H19FN3O4.W/c1-20(2)11-6-4-9(8-12(24-3)14(11)17)15(22)18-10-5-7-13(21)19-16(10)23;/h4,6,10,14H,5,7H2,1-3H3,(H,18,22)(H,19,21,23);/q-1; |
| InChIKey | QDTQGVVMXAHGGI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.18 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|