C13H12F2N3O3W- — CID 171846820
4-amino-N-(2,6-dioxopiperidin-3-yl)-3,6-difluorocyclohepta-1,4,6-triene-1-carboxamide;tungsten (PubChem CID 171846820) has the molecular formula C13H12F2N3O3W- and a molecular weight of 480.09 g/mol. Its IUPAC name is 4-amino-N-(2,6-dioxopiperidin-3-yl)-3,6-difluorocyclohepta-1,4,6-triene-1-carboxamide;tungsten.
| Compound Name | 4-amino-N-(2,6-dioxopiperidin-3-yl)-3,6-difluorocyclohepta-1,4,6-triene-1-carboxamide;tungsten |
|---|---|
| PubChem CID | 171846820 |
| Molecular Formula | C13H12F2N3O3W- |
| Molecular Weight | 480.09 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 4-amino-N-(2,6-dioxopiperidin-3-yl)-3,6-difluorocyclohepta-1,4,6-triene-1-carboxamide;tungsten |
| SMILES | NC1=CC(F)=[C-]C(C(=O)NC2CCC(=O)NC2=O)=CC1F.[W] |
| InChI | InChI=1S/C13H12F2N3O3.W/c14-7-3-6(4-8(15)9(16)5-7)12(20)17-10-1-2-11(19)18-13(10)21;/h4-5,8,10H,1-2,16H2,(H,17,20)(H,18,19,21);/q-1; |
| InChIKey | GJJYXZLHPBOUNI-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.09 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|