C15H16F2N3O3W- — CID 166077672
4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-2,6-difluorocyclohepta-1,3,6-triene-1-carboxamide;tungsten (PubChem CID 166077672) has the molecular formula C15H16F2N3O3W- and a molecular weight of 508.15 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-2,6-difluorocyclohepta-1,3,6-triene-1-carboxamide;tungsten.
| Compound Name | 4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-2,6-difluorocyclohepta-1,3,6-triene-1-carboxamide;tungsten |
|---|---|
| PubChem CID | 166077672 |
| Molecular Formula | C15H16F2N3O3W- |
| Molecular Weight | 508.15 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 4-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)-2,6-difluorocyclohepta-1,3,6-triene-1-carboxamide;tungsten |
| SMILES | CN(C)C1=CC(F)=C(C(=O)NC2CCC(=O)NC2=O)[C-]=C(F)C1.[W] |
| InChI | InChI=1S/C15H16F2N3O3.W/c1-20(2)9-5-8(16)6-10(11(17)7-9)14(22)18-12-3-4-13(21)19-15(12)23;/h7,12H,3-5H2,1-2H3,(H,18,22)(H,19,21,23);/q-1; |
| InChIKey | IBLNRNDBBMEHIA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|