C13H14FN3O3 — CID 103296597
5-amino-N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-methylbenzamide (PubChem CID 103296597) has the molecular formula C13H14FN3O3 and a molecular weight of 279.27 g/mol. Its IUPAC name is 5-amino-N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-methylbenzamide.
| Compound Name | 5-amino-N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 103296597 |
| Molecular Formula | C13H14FN3O3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 5-amino-N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-methylbenzamide |
| SMILES | Cc1cc(N)cc(C(=O)NC2CCC(=O)NC2=O)c1F |
| InChI | InChI=1S/C13H14FN3O3/c1-6-4-7(15)5-8(11(6)14)12(19)16-9-2-3-10(18)17-13(9)20/h4-5,9H,2-3,15H2,1H3,(H,16,19)(H,17,18,20) |
| InChIKey | CLEUISPSSBOMMF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|