C16H19N3O4S — CID 168987751
N-(2,6-dioxopiperidin-3-yl)-2-methyl-5-(4-oxopiperidin-1-yl)thiophene-3-carboxamide (PubChem CID 168987751) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-methyl-5-(4-oxopiperidin-1-yl)thiophene-3-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-methyl-5-(4-oxopiperidin-1-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 168987751 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-methyl-5-(4-oxopiperidin-1-yl)thiophene-3-carboxamide |
| SMILES | Cc1sc(N2CCC(=O)CC2)cc1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H19N3O4S/c1-9-11(8-14(24-9)19-6-4-10(20)5-7-19)15(22)17-12-2-3-13(21)18-16(12)23/h8,12H,2-7H2,1H3,(H,17,22)(H,18,21,23) |
| InChIKey | FQEHDRDJURUVOY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|