C12H16N4O3 — CID 103894268
N-(2,6-dioxopiperidin-3-yl)-3-ethyl-1-methylpyrazole-4-carboxamide (PubChem CID 103894268) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-3-ethyl-1-methylpyrazole-4-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-3-ethyl-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 103894268 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-3-ethyl-1-methylpyrazole-4-carboxamide |
| SMILES | CCc1nn(C)cc1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C12H16N4O3/c1-3-8-7(6-16(2)15-8)11(18)13-9-4-5-10(17)14-12(9)19/h6,9H,3-5H2,1-2H3,(H,13,18)(H,14,17,19) |
| InChIKey | KTFNSUIMBUHACP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|