C12H13FN3O3+ — CID 155583990
[4-[[(3S)-2,6-dioxopiperidin-3-yl]carbamoyl]-3-fluorophenyl]azanium (PubChem CID 155583990) has the molecular formula C12H13FN3O3+ and a molecular weight of 266.25 g/mol. Its IUPAC name is [4-[[(3S)-2,6-dioxopiperidin-3-yl]carbamoyl]-3-fluorophenyl]azanium.
| Compound Name | [4-[[(3S)-2,6-dioxopiperidin-3-yl]carbamoyl]-3-fluorophenyl]azanium |
|---|---|
| PubChem CID | 155583990 |
| Molecular Formula | C12H13FN3O3+ |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [4-[[(3S)-2,6-dioxopiperidin-3-yl]carbamoyl]-3-fluorophenyl]azanium |
| SMILES | [NH3+]c1ccc(C(=O)N[C@H]2CCC(=O)NC2=O)c(F)c1 |
| InChI | InChI=1S/C12H12FN3O3/c13-8-5-6(14)1-2-7(8)11(18)15-9-3-4-10(17)16-12(9)19/h1-2,5,9H,3-4,14H2,(H,15,18)(H,16,17,19)/p+1/t9-/m0/s1 |
| InChIKey | PDXLABFIWQGDLW-VIFPVBQESA-O |
| XLogP | -0.77 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|