C14H17N3O3 — CID 166077676
4-amino-N-[(3R)-2,6-dioxopiperidin-3-yl]-3-methylcyclohepta-1,3,6-triene-1-carboxamide (PubChem CID 166077676) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-amino-N-[(3R)-2,6-dioxopiperidin-3-yl]-3-methylcyclohepta-1,3,6-triene-1-carboxamide.
| Compound Name | 4-amino-N-[(3R)-2,6-dioxopiperidin-3-yl]-3-methylcyclohepta-1,3,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 166077676 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-amino-N-[(3R)-2,6-dioxopiperidin-3-yl]-3-methylcyclohepta-1,3,6-triene-1-carboxamide |
| SMILES | CC1=C(N)CC=CC(C(=O)N[C@@H]2CCC(=O)NC2=O)=C1 |
| InChI | InChI=1S/C14H17N3O3/c1-8-7-9(3-2-4-10(8)15)13(19)16-11-5-6-12(18)17-14(11)20/h2-3,7,11H,4-6,15H2,1H3,(H,16,19)(H,17,18,20)/t11-/m1/s1 |
| InChIKey | KATKTEQDMZCUFG-LLVKDONJSA-N |
| XLogP | 0.03 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|