C8H12N2O3S — CID 107031614
N-(2,6-dioxopiperidin-3-yl)-2-sulfanylpropanamide (PubChem CID 107031614) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-sulfanylpropanamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107031614 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-sulfanylpropanamide |
| SMILES | CC(S)C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C8H12N2O3S/c1-4(14)7(12)9-5-2-3-6(11)10-8(5)13/h4-5,14H,2-3H2,1H3,(H,9,12)(H,10,11,13) |
| InChIKey | NLDFBGJSWYLPCZ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|